C42H34N8 — CID 135521752
N'-[[4-[[[(4-methylanilino)-quinolin-2-ylmethylidene]hydrazinylidene]methyl]phenyl]methylideneamino]-N-(4-methylphenyl)quinoline-2-carboximidamide (PubChem CID 135521752) has the molecular formula C42H34N8 and a molecular weight of 650.79 g/mol. Its IUPAC name is N'-[[4-[[[(4-methylanilino)-quinolin-2-ylmethylidene]hydrazinylidene]methyl]phenyl]methylideneamino]-N-(4-methylphenyl)quinoline-2-carboximidamide.
| Compound Name | N'-[[4-[[[(4-methylanilino)-quinolin-2-ylmethylidene]hydrazinylidene]methyl]phenyl]methylideneamino]-N-(4-methylphenyl)quinoline-2-carboximidamide |
|---|---|
| PubChem CID | 135521752 |
| Molecular Formula | C42H34N8 |
| Molecular Weight | 650.79 g/mol |
| Exact Mass | 650.29 |
| IUPAC Name | N'-[[4-[[[(4-methylanilino)-quinolin-2-ylmethylidene]hydrazinylidene]methyl]phenyl]methylideneamino]-N-(4-methylphenyl)quinoline-2-carboximidamide |
| SMILES | Cc1ccc(NC(=NN=Cc2ccc(C=NN=C(Nc3ccc(C)cc3)c3ccc4ccccc4n3)cc2)c2ccc3ccccc3n2)cc1 |
| InChI | InChI=1S/C42H34N8/c1-29-11-21-35(22-12-29)45-41(39-25-19-33-7-3-5-9-37(33)47-39)49-43-27-31-15-17-32(18-16-31)28-44-50-42(46-36-23-13-30(2)14-24-36)40-26-20-34-8-4-6-10-38(34)48-40/h3-28H,1-2H3,(H,45,49)(H,46,50) |
| InChIKey | VKOBNOIOAUWAGW-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 99.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.79 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|