C33H26N6 — CID 135602467
N'-[(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]-N-(4-methylphenyl)quinoline-2-carboximidamide (PubChem CID 135602467) has the molecular formula C33H26N6 and a molecular weight of 506.61 g/mol. Its IUPAC name is N'-[(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]-N-(4-methylphenyl)quinoline-2-carboximidamide.
| Compound Name | N'-[(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]-N-(4-methylphenyl)quinoline-2-carboximidamide |
|---|---|
| PubChem CID | 135602467 |
| Molecular Formula | C33H26N6 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | N'-[(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]-N-(4-methylphenyl)quinoline-2-carboximidamide |
| SMILES | Cc1ccc(N/C(=N\N=C\c2cn(-c3ccccc3)nc2-c2ccccc2)c2ccc3ccccc3n2)cc1 |
| InChI | InChI=1S/C33H26N6/c1-24-16-19-28(20-17-24)35-33(31-21-18-25-10-8-9-15-30(25)36-31)37-34-22-27-23-39(29-13-6-3-7-14-29)38-32(27)26-11-4-2-5-12-26/h2-23H,1H3,(H,35,37)/b34-22+ |
| InChIKey | UZUFYVSUFACFPO-PPOKSSTKSA-N |
| XLogP | 7.29 |
| TPSA | 67.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|