C25H19N5 — CID 5213107
N-[(1,3-diphenylpyrazol-4-yl)methylideneamino]quinolin-2-amine (PubChem CID 5213107) has the molecular formula C25H19N5 and a molecular weight of 389.46 g/mol. Its IUPAC name is N-[(1,3-diphenylpyrazol-4-yl)methylideneamino]quinolin-2-amine.
| Compound Name | N-[(1,3-diphenylpyrazol-4-yl)methylideneamino]quinolin-2-amine |
|---|---|
| PubChem CID | 5213107 |
| Molecular Formula | C25H19N5 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | N-[(1,3-diphenylpyrazol-4-yl)methylideneamino]quinolin-2-amine |
| SMILES | C(=NNc1ccc2ccccc2n1)c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C25H19N5/c1-3-10-20(11-4-1)25-21(18-30(29-25)22-12-5-2-6-13-22)17-26-28-24-16-15-19-9-7-8-14-23(19)27-24/h1-18H,(H,27,28) |
| InChIKey | XOYJDJJLYAYSMU-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|