C21H17N5 — CID 84931945
N-[(1,3-diphenylpyrazol-4-yl)methylideneamino]pyridin-2-amine (PubChem CID 84931945) has the molecular formula C21H17N5 and a molecular weight of 339.40 g/mol. Its IUPAC name is N-[(1,3-diphenylpyrazol-4-yl)methylideneamino]pyridin-2-amine.
| Compound Name | N-[(1,3-diphenylpyrazol-4-yl)methylideneamino]pyridin-2-amine |
|---|---|
| PubChem CID | 84931945 |
| Molecular Formula | C21H17N5 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | N-[(1,3-diphenylpyrazol-4-yl)methylideneamino]pyridin-2-amine |
| SMILES | C(=NNc1ccccn1)c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C21H17N5/c1-3-9-17(10-4-1)21-18(15-23-24-20-13-7-8-14-22-20)16-26(25-21)19-11-5-2-6-12-19/h1-16H,(H,22,24) |
| InChIKey | OUFUSHFBHNCTSV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|