C28H25N5 — CID 3926285
N-[(1,3-diphenylpyrazol-4-yl)methylideneamino]-4,6,8-trimethylquinolin-2-amine (PubChem CID 3926285) has the molecular formula C28H25N5 and a molecular weight of 431.54 g/mol. Its IUPAC name is N-[(1,3-diphenylpyrazol-4-yl)methylideneamino]-4,6,8-trimethylquinolin-2-amine.
| Compound Name | N-[(1,3-diphenylpyrazol-4-yl)methylideneamino]-4,6,8-trimethylquinolin-2-amine |
|---|---|
| PubChem CID | 3926285 |
| Molecular Formula | C28H25N5 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | N-[(1,3-diphenylpyrazol-4-yl)methylideneamino]-4,6,8-trimethylquinolin-2-amine |
| SMILES | Cc1cc(C)c2nc(NN=Cc3cn(-c4ccccc4)nc3-c3ccccc3)cc(C)c2c1 |
| InChI | InChI=1S/C28H25N5/c1-19-14-21(3)27-25(15-19)20(2)16-26(30-27)31-29-17-23-18-33(24-12-8-5-9-13-24)32-28(23)22-10-6-4-7-11-22/h4-18H,1-3H3,(H,30,31) |
| InChIKey | CSLFXHFZCRJYBB-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|