C25H24N4 — CID 21236227
N-[(E)-[3-(4-ethylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4-methylaniline (PubChem CID 21236227) has the molecular formula C25H24N4 and a molecular weight of 380.50 g/mol. Its IUPAC name is N-[(E)-[3-(4-ethylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4-methylaniline.
| Compound Name | N-[(E)-[3-(4-ethylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4-methylaniline |
|---|---|
| PubChem CID | 21236227 |
| Molecular Formula | C25H24N4 |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | N-[(E)-[3-(4-ethylphenyl)-1-phenylpyrazol-4-yl]methylideneamino]-4-methylaniline |
| SMILES | CCc1ccc(-c2nn(-c3ccccc3)cc2/C=N/Nc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H24N4/c1-3-20-11-13-21(14-12-20)25-22(17-26-27-23-15-9-19(2)10-16-23)18-29(28-25)24-7-5-4-6-8-24/h4-18,27H,3H2,1-2H3/b26-17+ |
| InChIKey | RDIUGHRXDFGPIK-YZSQISJMSA-N |
| XLogP | 5.86 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|