C24H21BN4O4 — CID 172942409
4-[3-(4-boronophenyl)-4-[(E)-[(4-methylphenyl)hydrazinylidene]methyl]pyrazol-1-yl]benzoic acid (PubChem CID 172942409) has the molecular formula C24H21BN4O4 and a molecular weight of 440.27 g/mol. Its IUPAC name is 4-[3-(4-boronophenyl)-4-[(E)-[(4-methylphenyl)hydrazinylidene]methyl]pyrazol-1-yl]benzoic acid.
| Compound Name | 4-[3-(4-boronophenyl)-4-[(E)-[(4-methylphenyl)hydrazinylidene]methyl]pyrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 172942409 |
| Molecular Formula | C24H21BN4O4 |
| Molecular Weight | 440.27 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 4-[3-(4-boronophenyl)-4-[(E)-[(4-methylphenyl)hydrazinylidene]methyl]pyrazol-1-yl]benzoic acid |
| SMILES | Cc1ccc(N/N=C/c2cn(-c3ccc(C(=O)O)cc3)nc2-c2ccc(B(O)O)cc2)cc1 |
| InChI | InChI=1S/C24H21BN4O4/c1-16-2-10-21(11-3-16)27-26-14-19-15-29(22-12-6-18(7-13-22)24(30)31)28-23(19)17-4-8-20(9-5-17)25(32)33/h2-15,27,32-33H,1H3,(H,30,31)/b26-14+ |
| InChIKey | JXGHBYGXLKXDLA-VULFUBBASA-N |
| XLogP | 2.67 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|