C25H21N3O4 — CID 155808677
4-[1-(4-carboxyphenyl)-4-[(4-methylanilino)methyl]pyrazol-3-yl]benzoic acid (PubChem CID 155808677) has the molecular formula C25H21N3O4 and a molecular weight of 427.46 g/mol. Its IUPAC name is 4-[1-(4-carboxyphenyl)-4-[(4-methylanilino)methyl]pyrazol-3-yl]benzoic acid.
| Compound Name | 4-[1-(4-carboxyphenyl)-4-[(4-methylanilino)methyl]pyrazol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 155808677 |
| Molecular Formula | C25H21N3O4 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 4-[1-(4-carboxyphenyl)-4-[(4-methylanilino)methyl]pyrazol-3-yl]benzoic acid |
| SMILES | Cc1ccc(NCc2cn(-c3ccc(C(=O)O)cc3)nc2-c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C25H21N3O4/c1-16-2-10-21(11-3-16)26-14-20-15-28(22-12-8-19(9-13-22)25(31)32)27-23(20)17-4-6-18(7-5-17)24(29)30/h2-13,15,26H,14H2,1H3,(H,29,30)(H,31,32) |
| InChIKey | NFEFXUZTJYQROX-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |