C24H21N3O3 — CID 155808729
4-[4-[(4-methoxyanilino)methyl]-3-phenylpyrazol-1-yl]benzoic acid (PubChem CID 155808729) has the molecular formula C24H21N3O3 and a molecular weight of 399.45 g/mol. Its IUPAC name is 4-[4-[(4-methoxyanilino)methyl]-3-phenylpyrazol-1-yl]benzoic acid.
| Compound Name | 4-[4-[(4-methoxyanilino)methyl]-3-phenylpyrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 155808729 |
| Molecular Formula | C24H21N3O3 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 4-[4-[(4-methoxyanilino)methyl]-3-phenylpyrazol-1-yl]benzoic acid |
| SMILES | COc1ccc(NCc2cn(-c3ccc(C(=O)O)cc3)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H21N3O3/c1-30-22-13-9-20(10-14-22)25-15-19-16-27(21-11-7-18(8-12-21)24(28)29)26-23(19)17-5-3-2-4-6-17/h2-14,16,25H,15H2,1H3,(H,28,29) |
| InChIKey | AUOMUQDRUOKQTP-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|