C23H15F4N3O2 — CID 171365029
4-[3-(4-fluorophenyl)-4-[(3,4,5-trifluoroanilino)methyl]pyrazol-1-yl]benzoic acid (PubChem CID 171365029) has the molecular formula C23H15F4N3O2 and a molecular weight of 441.38 g/mol. Its IUPAC name is 4-[3-(4-fluorophenyl)-4-[(3,4,5-trifluoroanilino)methyl]pyrazol-1-yl]benzoic acid.
| Compound Name | 4-[3-(4-fluorophenyl)-4-[(3,4,5-trifluoroanilino)methyl]pyrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 171365029 |
| Molecular Formula | C23H15F4N3O2 |
| Molecular Weight | 441.38 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 4-[3-(4-fluorophenyl)-4-[(3,4,5-trifluoroanilino)methyl]pyrazol-1-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-n2cc(CNc3cc(F)c(F)c(F)c3)c(-c3ccc(F)cc3)n2)cc1 |
| InChI | InChI=1S/C23H15F4N3O2/c24-16-5-1-13(2-6-16)22-15(11-28-17-9-19(25)21(27)20(26)10-17)12-30(29-22)18-7-3-14(4-8-18)23(31)32/h1-10,12,28H,11H2,(H,31,32) |
| InChIKey | RZYKWRZMRQSKAU-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.38 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|