C24H23N3 — CID 53474364
4-methyl-N-[[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methyl]aniline (PubChem CID 53474364) has the molecular formula C24H23N3 and a molecular weight of 353.47 g/mol. Its IUPAC name is 4-methyl-N-[[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methyl]aniline.
| Compound Name | 4-methyl-N-[[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methyl]aniline |
|---|---|
| PubChem CID | 53474364 |
| Molecular Formula | C24H23N3 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 4-methyl-N-[[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]methyl]aniline |
| SMILES | Cc1ccc(NCc2cn(-c3ccccc3)nc2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H23N3/c1-18-8-12-20(13-9-18)24-21(16-25-22-14-10-19(2)11-15-22)17-27(26-24)23-6-4-3-5-7-23/h3-15,17,25H,16H2,1-2H3 |
| InChIKey | MHXDVYYNSCBZQL-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |