C22H21N5 — CID 31536512
N-[(1,3-diphenylpyrazol-4-yl)methyl]-4,6-dimethylpyrimidin-2-amine (PubChem CID 31536512) has the molecular formula C22H21N5 and a molecular weight of 355.45 g/mol. Its IUPAC name is N-[(1,3-diphenylpyrazol-4-yl)methyl]-4,6-dimethylpyrimidin-2-amine.
| Compound Name | N-[(1,3-diphenylpyrazol-4-yl)methyl]-4,6-dimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 31536512 |
| Molecular Formula | C22H21N5 |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | N-[(1,3-diphenylpyrazol-4-yl)methyl]-4,6-dimethylpyrimidin-2-amine |
| SMILES | Cc1cc(C)nc(NCc2cn(-c3ccccc3)nc2-c2ccccc2)n1 |
| InChI | InChI=1S/C22H21N5/c1-16-13-17(2)25-22(24-16)23-14-19-15-27(20-11-7-4-8-12-20)26-21(19)18-9-5-3-6-10-18/h3-13,15H,14H2,1-2H3,(H,23,24,25) |
| InChIKey | GSZFZEYISOEJMK-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |