About N-[(1,3-diphenylpyrazol-4-yl)methyl]-1-phenylmethanamine;hydrochloride
N-[(1,3-diphenylpyrazol-4-yl)methyl]-1-phenylmethanamine;hydrochloride (PubChem CID 51110159) has the molecular formula C23H22ClN3
and a molecular weight of 375.90 g/mol. Its IUPAC name is N-[(1,3-diphenylpyrazol-4-yl)methyl]-1-phenylmethanamine;hydrochloride.
Molecular Properties
| Compound Name | N-[(1,3-diphenylpyrazol-4-yl)methyl]-1-phenylmethanamine;hydrochloride |
| PubChem CID | 51110159 |
| Molecular Formula | C23H22ClN3 |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | N-[(1,3-diphenylpyrazol-4-yl)methyl]-1-phenylmethanamine;hydrochloride |
| SMILES | Cl.c1ccc(CNCc2cn(-c3ccccc3)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H21N3.ClH/c1-4-10-19(11-5-1)16-24-17-21-18-26(22-14-8-3-9-15-22)25-23(21)20-12-6-2-7-13-20;/h1-15,18,24H,16-17H2;1H |
| InChIKey | MNYZYKNUGKPLGB-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1,3-diphenylpyrazol-4-yl)methyl]-1-phenylmethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,3-diphenylpyrazol-4-yl)methyl]-1-phenylmethanamine;hydrochloride?
The IUPAC name of N-[(1,3-diphenylpyrazol-4-yl)methyl]-1-phenylmethanamine;hydrochloride (CID 51110159) is N-[(1,3-diphenylpyrazol-4-yl)methyl]-1-phenylmethanamine;hydrochloride.
What is the SMILES notation for N-[(1,3-diphenylpyrazol-4-yl)methyl]-1-phenylmethanamine;hydrochloride?
The canonical SMILES for N-[(1,3-diphenylpyrazol-4-yl)methyl]-1-phenylmethanamine;hydrochloride is Cl.c1ccc(CNCc2cn(-c3ccccc3)nc2-c2ccccc2)cc1.
What is the InChIKey of N-[(1,3-diphenylpyrazol-4-yl)methyl]-1-phenylmethanamine;hydrochloride?
The InChIKey is MNYZYKNUGKPLGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21N3.ClH/c1-4-10-19(11-5-1)16-24-17-21-18-26(22-14-8-3-9-15-22)25-23(21)20-12-6-2-7-13-20;/h1-15,18,24H,16-17H2;1H.
What are the key properties of N-[(1,3-diphenylpyrazol-4-yl)methyl]-1-phenylmethanamine;hydrochloride?
N-[(1,3-diphenylpyrazol-4-yl)methyl]-1-phenylmethanamine;hydrochloride has a molecular weight of 375.90 g/mol, XLogP of 5.25, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,3-diphenylpyrazol-4-yl)methyl]-1-phenylmethanamine;hydrochloride is sourced from PubChem (CID 51110159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).