C17H18N4O — CID 17445531
2-[(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)methylamino]ethanol (PubChem CID 17445531) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is 2-[(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)methylamino]ethanol.
| Compound Name | 2-[(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)methylamino]ethanol |
|---|---|
| PubChem CID | 17445531 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 2-[(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)methylamino]ethanol |
| SMILES | OCCNCc1cn(-c2ccccc2)nc1-c1cccnc1 |
| InChI | InChI=1S/C17H18N4O/c22-10-9-19-12-15-13-21(16-6-2-1-3-7-16)20-17(15)14-5-4-8-18-11-14/h1-8,11,13,19,22H,9-10,12H2 |
| InChIKey | IQEVMPZRTZNZLY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|