C22H26N4O — CID 119109389
3-(cyclopropylmethoxy)-N-[(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)methyl]propan-1-amine (PubChem CID 119109389) has the molecular formula C22H26N4O and a molecular weight of 362.48 g/mol. Its IUPAC name is 3-(cyclopropylmethoxy)-N-[(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)methyl]propan-1-amine.
| Compound Name | 3-(cyclopropylmethoxy)-N-[(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 119109389 |
| Molecular Formula | C22H26N4O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 3-(cyclopropylmethoxy)-N-[(1-phenyl-3-pyridin-3-ylpyrazol-4-yl)methyl]propan-1-amine |
| SMILES | c1ccc(-n2cc(CNCCCOCC3CC3)c(-c3cccnc3)n2)cc1 |
| InChI | InChI=1S/C22H26N4O/c1-2-7-21(8-3-1)26-16-20(22(25-26)19-6-4-11-23-14-19)15-24-12-5-13-27-17-18-9-10-18/h1-4,6-8,11,14,16,18,24H,5,9-10,12-13,15,17H2 |
| InChIKey | QAZHDJSQXYRRQH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|