C24H31N5 — CID 119109290
N-[(1,3-diphenylpyrazol-4-yl)methyl]-3-(4-methylpiperazin-1-yl)propan-1-amine (PubChem CID 119109290) has the molecular formula C24H31N5 and a molecular weight of 389.55 g/mol. Its IUPAC name is N-[(1,3-diphenylpyrazol-4-yl)methyl]-3-(4-methylpiperazin-1-yl)propan-1-amine.
| Compound Name | N-[(1,3-diphenylpyrazol-4-yl)methyl]-3-(4-methylpiperazin-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 119109290 |
| Molecular Formula | C24H31N5 |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 389.26 |
| IUPAC Name | N-[(1,3-diphenylpyrazol-4-yl)methyl]-3-(4-methylpiperazin-1-yl)propan-1-amine |
| SMILES | CN1CCN(CCCNCc2cn(-c3ccccc3)nc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C24H31N5/c1-27-15-17-28(18-16-27)14-8-13-25-19-22-20-29(23-11-6-3-7-12-23)26-24(22)21-9-4-2-5-10-21/h2-7,9-12,20,25H,8,13-19H2,1H3 |
| InChIKey | WMBGDJPPKMJJDC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|