C26H32N4O — CID 46295921
3-(1,3-diphenylpyrazol-4-yl)-N-(3-piperidin-1-ylpropyl)propanamide (PubChem CID 46295921) has the molecular formula C26H32N4O and a molecular weight of 416.57 g/mol. Its IUPAC name is 3-(1,3-diphenylpyrazol-4-yl)-N-(3-piperidin-1-ylpropyl)propanamide.
| Compound Name | 3-(1,3-diphenylpyrazol-4-yl)-N-(3-piperidin-1-ylpropyl)propanamide |
|---|---|
| PubChem CID | 46295921 |
| Molecular Formula | C26H32N4O |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | 3-(1,3-diphenylpyrazol-4-yl)-N-(3-piperidin-1-ylpropyl)propanamide |
| SMILES | O=C(CCc1cn(-c2ccccc2)nc1-c1ccccc1)NCCCN1CCCCC1 |
| InChI | InChI=1S/C26H32N4O/c31-25(27-17-10-20-29-18-8-3-9-19-29)16-15-23-21-30(24-13-6-2-7-14-24)28-26(23)22-11-4-1-5-12-22/h1-2,4-7,11-14,21H,3,8-10,15-20H2,(H,27,31) |
| InChIKey | HXUPGVWHUQEHMM-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|