C22H25N5O2 — CID 31340751
5-(carbamoylamino)-N-[(1,3-diphenylpyrazol-4-yl)methyl]pentanamide (PubChem CID 31340751) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is 5-(carbamoylamino)-N-[(1,3-diphenylpyrazol-4-yl)methyl]pentanamide.
| Compound Name | 5-(carbamoylamino)-N-[(1,3-diphenylpyrazol-4-yl)methyl]pentanamide |
|---|---|
| PubChem CID | 31340751 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 5-(carbamoylamino)-N-[(1,3-diphenylpyrazol-4-yl)methyl]pentanamide |
| SMILES | NC(=O)NCCCCC(=O)NCc1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C22H25N5O2/c23-22(29)24-14-8-7-13-20(28)25-15-18-16-27(19-11-5-2-6-12-19)26-21(18)17-9-3-1-4-10-17/h1-6,9-12,16H,7-8,13-15H2,(H,25,28)(H3,23,24,29) |
| InChIKey | ORHMYFHMARCPPH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|