C24H28N4O2 — CID 56538169
N'-[(1,3-diphenylpyrazol-4-yl)methyl]-N'-methyl-N-propylbutanediamide (PubChem CID 56538169) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is N'-[(1,3-diphenylpyrazol-4-yl)methyl]-N'-methyl-N-propylbutanediamide.
| Compound Name | N'-[(1,3-diphenylpyrazol-4-yl)methyl]-N'-methyl-N-propylbutanediamide |
|---|---|
| PubChem CID | 56538169 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | N'-[(1,3-diphenylpyrazol-4-yl)methyl]-N'-methyl-N-propylbutanediamide |
| SMILES | CCCNC(=O)CCC(=O)N(C)Cc1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C24H28N4O2/c1-3-16-25-22(29)14-15-23(30)27(2)17-20-18-28(21-12-8-5-9-13-21)26-24(20)19-10-6-4-7-11-19/h4-13,18H,3,14-17H2,1-2H3,(H,25,29) |
| InChIKey | ZXKRVWCDRIBHDO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |