C22H26N4O — CID 8915077
2-[(1,3-diphenylpyrazol-4-yl)methyl-methylamino]-N-propylacetamide (PubChem CID 8915077) has the molecular formula C22H26N4O and a molecular weight of 362.48 g/mol. Its IUPAC name is 2-[(1,3-diphenylpyrazol-4-yl)methyl-methylamino]-N-propylacetamide.
| Compound Name | 2-[(1,3-diphenylpyrazol-4-yl)methyl-methylamino]-N-propylacetamide |
|---|---|
| PubChem CID | 8915077 |
| Molecular Formula | C22H26N4O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 2-[(1,3-diphenylpyrazol-4-yl)methyl-methylamino]-N-propylacetamide |
| SMILES | CCCNC(=O)CN(C)Cc1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C22H26N4O/c1-3-14-23-21(27)17-25(2)15-19-16-26(20-12-8-5-9-13-20)24-22(19)18-10-6-4-7-11-18/h4-13,16H,3,14-15,17H2,1-2H3,(H,23,27) |
| InChIKey | VVMSPFFMXYOPFN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |