C25H25N3O — CID 31927363
(1R)-2-[(1,3-diphenylpyrazol-4-yl)methyl-methylamino]-1-phenylethanol (PubChem CID 31927363) has the molecular formula C25H25N3O and a molecular weight of 383.50 g/mol. Its IUPAC name is (1R)-2-[(1,3-diphenylpyrazol-4-yl)methyl-methylamino]-1-phenylethanol.
| Compound Name | (1R)-2-[(1,3-diphenylpyrazol-4-yl)methyl-methylamino]-1-phenylethanol |
|---|---|
| PubChem CID | 31927363 |
| Molecular Formula | C25H25N3O |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | (1R)-2-[(1,3-diphenylpyrazol-4-yl)methyl-methylamino]-1-phenylethanol |
| SMILES | CN(Cc1cn(-c2ccccc2)nc1-c1ccccc1)C[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C25H25N3O/c1-27(19-24(29)20-11-5-2-6-12-20)17-22-18-28(23-15-9-4-10-16-23)26-25(22)21-13-7-3-8-14-21/h2-16,18,24,29H,17,19H2,1H3/t24-/m0/s1 |
| InChIKey | IPHTUKOHIDOKNZ-DEOSSOPVSA-N |
| XLogP | 4.70 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |