C23H27N3O — CID 46523369
N-[(1,3-diphenylpyrazol-4-yl)methyl]-N,4-dimethylpentanamide (PubChem CID 46523369) has the molecular formula C23H27N3O and a molecular weight of 361.49 g/mol. Its IUPAC name is N-[(1,3-diphenylpyrazol-4-yl)methyl]-N,4-dimethylpentanamide.
| Compound Name | N-[(1,3-diphenylpyrazol-4-yl)methyl]-N,4-dimethylpentanamide |
|---|---|
| PubChem CID | 46523369 |
| Molecular Formula | C23H27N3O |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | N-[(1,3-diphenylpyrazol-4-yl)methyl]-N,4-dimethylpentanamide |
| SMILES | CC(C)CCC(=O)N(C)Cc1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C23H27N3O/c1-18(2)14-15-22(27)25(3)16-20-17-26(21-12-8-5-9-13-21)24-23(20)19-10-6-4-7-11-19/h4-13,17-18H,14-16H2,1-3H3 |
| InChIKey | BAFDYRNSZQVVHW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |