C22H26Cl2N4O — CID 119688729
N-[[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl]-N-methyl-4-(methylamino)butanamide;hydrochloride (PubChem CID 119688729) has the molecular formula C22H26Cl2N4O and a molecular weight of 433.38 g/mol. Its IUPAC name is N-[[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl]-N-methyl-4-(methylamino)butanamide;hydrochloride.
| Compound Name | N-[[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl]-N-methyl-4-(methylamino)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119688729 |
| Molecular Formula | C22H26Cl2N4O |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | N-[[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl]-N-methyl-4-(methylamino)butanamide;hydrochloride |
| SMILES | CNCCCC(=O)N(C)Cc1cn(-c2ccccc2)nc1-c1ccc(Cl)cc1.Cl |
| InChI | InChI=1S/C22H25ClN4O.ClH/c1-24-14-6-9-21(28)26(2)15-18-16-27(20-7-4-3-5-8-20)25-22(18)17-10-12-19(23)13-11-17;/h3-5,7-8,10-13,16,24H,6,9,14-15H2,1-2H3;1H |
| InChIKey | ALALMIPOXMVAPP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|