C22H27ClN4O2 — CID 119689500
N-[(1,3-diphenylpyrazol-4-yl)methyl]-2-(2-methoxyethylamino)-N-methylacetamide;hydrochloride (PubChem CID 119689500) has the molecular formula C22H27ClN4O2 and a molecular weight of 414.94 g/mol. Its IUPAC name is N-[(1,3-diphenylpyrazol-4-yl)methyl]-2-(2-methoxyethylamino)-N-methylacetamide;hydrochloride.
| Compound Name | N-[(1,3-diphenylpyrazol-4-yl)methyl]-2-(2-methoxyethylamino)-N-methylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119689500 |
| Molecular Formula | C22H27ClN4O2 |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | N-[(1,3-diphenylpyrazol-4-yl)methyl]-2-(2-methoxyethylamino)-N-methylacetamide;hydrochloride |
| SMILES | COCCNCC(=O)N(C)Cc1cn(-c2ccccc2)nc1-c1ccccc1.Cl |
| InChI | InChI=1S/C22H26N4O2.ClH/c1-25(21(27)15-23-13-14-28-2)16-19-17-26(20-11-7-4-8-12-20)24-22(19)18-9-5-3-6-10-18;/h3-12,17,23H,13-16H2,1-2H3;1H |
| InChIKey | HLVNBQIWZMIPOS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|