C20H25Cl2N5O2 — CID 119870904
2-(2-methoxyethylamino)-N-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methyl]acetamide;dihydrochloride (PubChem CID 119870904) has the molecular formula C20H25Cl2N5O2 and a molecular weight of 438.36 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-N-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methyl]acetamide;dihydrochloride.
| Compound Name | 2-(2-methoxyethylamino)-N-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119870904 |
| Molecular Formula | C20H25Cl2N5O2 |
| Molecular Weight | 438.36 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 2-(2-methoxyethylamino)-N-[(1-phenyl-3-pyridin-4-ylpyrazol-4-yl)methyl]acetamide;dihydrochloride |
| SMILES | COCCNCC(=O)NCc1cn(-c2ccccc2)nc1-c1ccncc1.Cl.Cl |
| InChI | InChI=1S/C20H23N5O2.2ClH/c1-27-12-11-22-14-19(26)23-13-17-15-25(18-5-3-2-4-6-18)24-20(17)16-7-9-21-10-8-16;;/h2-10,15,22H,11-14H2,1H3,(H,23,26);2*1H |
| InChIKey | CHQKANIXDUAKGP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|