C27H27N3O3 — CID 55996599
N-[(1,3-diphenylpyrazol-4-yl)methyl]-2-(2-methoxyethoxy)-N-methylbenzamide (PubChem CID 55996599) has the molecular formula C27H27N3O3 and a molecular weight of 441.53 g/mol. Its IUPAC name is N-[(1,3-diphenylpyrazol-4-yl)methyl]-2-(2-methoxyethoxy)-N-methylbenzamide.
| Compound Name | N-[(1,3-diphenylpyrazol-4-yl)methyl]-2-(2-methoxyethoxy)-N-methylbenzamide |
|---|---|
| PubChem CID | 55996599 |
| Molecular Formula | C27H27N3O3 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | N-[(1,3-diphenylpyrazol-4-yl)methyl]-2-(2-methoxyethoxy)-N-methylbenzamide |
| SMILES | COCCOc1ccccc1C(=O)N(C)Cc1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C27H27N3O3/c1-29(27(31)24-15-9-10-16-25(24)33-18-17-32-2)19-22-20-30(23-13-7-4-8-14-23)28-26(22)21-11-5-3-6-12-21/h3-16,20H,17-19H2,1-2H3 |
| InChIKey | NJSSRVZFFMXMMK-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|