C23H24N6O2 — CID 9331790
N-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-1-(1,3-diphenylpyrazol-4-yl)-N-methylmethanamine (PubChem CID 9331790) has the molecular formula C23H24N6O2 and a molecular weight of 416.49 g/mol. Its IUPAC name is N-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-1-(1,3-diphenylpyrazol-4-yl)-N-methylmethanamine.
| Compound Name | N-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-1-(1,3-diphenylpyrazol-4-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 9331790 |
| Molecular Formula | C23H24N6O2 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | N-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-1-(1,3-diphenylpyrazol-4-yl)-N-methylmethanamine |
| SMILES | Cc1nn(CN(C)Cc2cn(-c3ccccc3)nc2-c2ccccc2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C23H24N6O2/c1-17-23(29(30)31)18(2)28(24-17)16-26(3)14-20-15-27(21-12-8-5-9-13-21)25-22(20)19-10-6-4-7-11-19/h4-13,15H,14,16H2,1-3H3 |
| InChIKey | AOKIVOILAPCBAK-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 82.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|