C26H24N8O3 — CID 19264842
1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[(1,3-diphenylpyrazol-4-yl)methyl]pyrazole-3-carboxamide (PubChem CID 19264842) has the molecular formula C26H24N8O3 and a molecular weight of 496.53 g/mol. Its IUPAC name is 1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[(1,3-diphenylpyrazol-4-yl)methyl]pyrazole-3-carboxamide.
| Compound Name | 1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[(1,3-diphenylpyrazol-4-yl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19264842 |
| Molecular Formula | C26H24N8O3 |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | 1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-N-[(1,3-diphenylpyrazol-4-yl)methyl]pyrazole-3-carboxamide |
| SMILES | Cc1nn(Cn2ccc(C(=O)NCc3cn(-c4ccccc4)nc3-c3ccccc3)n2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C26H24N8O3/c1-18-25(34(36)37)19(2)33(28-18)17-31-14-13-23(29-31)26(35)27-15-21-16-32(22-11-7-4-8-12-22)30-24(21)20-9-5-3-6-10-20/h3-14,16H,15,17H2,1-2H3,(H,27,35) |
| InChIKey | CYVANZJLYWXVCL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 125.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|