C20H21N9O5 — CID 19265001
4-[[1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]pyrazole-3-carbonyl]amino]-N-(furan-2-ylmethyl)-1-methylpyrazole-3-carboxamide (PubChem CID 19265001) has the molecular formula C20H21N9O5 and a molecular weight of 467.45 g/mol. Its IUPAC name is 4-[[1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]pyrazole-3-carbonyl]amino]-N-(furan-2-ylmethyl)-1-methylpyrazole-3-carboxamide.
| Compound Name | 4-[[1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]pyrazole-3-carbonyl]amino]-N-(furan-2-ylmethyl)-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19265001 |
| Molecular Formula | C20H21N9O5 |
| Molecular Weight | 467.45 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 4-[[1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]pyrazole-3-carbonyl]amino]-N-(furan-2-ylmethyl)-1-methylpyrazole-3-carboxamide |
| SMILES | Cc1nn(Cn2ccc(C(=O)Nc3cn(C)nc3C(=O)NCc3ccco3)n2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H21N9O5/c1-12-18(29(32)33)13(2)28(23-12)11-27-7-6-15(24-27)19(30)22-16-10-26(3)25-17(16)20(31)21-9-14-5-4-8-34-14/h4-8,10H,9,11H2,1-3H3,(H,21,31)(H,22,30) |
| InChIKey | NNTVLTYRVYQCSA-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 167.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.45 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|