C14H12ClN7O5 — CID 135803724
4-[(4-chloro-5-nitro-1H-pyrazole-3-carbonyl)amino]-N-(furan-2-ylmethyl)-1-methylpyrazole-3-carboxamide (PubChem CID 135803724) has the molecular formula C14H12ClN7O5 and a molecular weight of 393.75 g/mol. Its IUPAC name is 4-[(4-chloro-5-nitro-1H-pyrazole-3-carbonyl)amino]-N-(furan-2-ylmethyl)-1-methylpyrazole-3-carboxamide.
| Compound Name | 4-[(4-chloro-5-nitro-1H-pyrazole-3-carbonyl)amino]-N-(furan-2-ylmethyl)-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 135803724 |
| Molecular Formula | C14H12ClN7O5 |
| Molecular Weight | 393.75 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 4-[(4-chloro-5-nitro-1H-pyrazole-3-carbonyl)amino]-N-(furan-2-ylmethyl)-1-methylpyrazole-3-carboxamide |
| SMILES | Cn1cc(NC(=O)c2n[nH]c([N+](=O)[O-])c2Cl)c(C(=O)NCc2ccco2)n1 |
| InChI | InChI=1S/C14H12ClN7O5/c1-21-6-8(10(20-21)13(23)16-5-7-3-2-4-27-7)17-14(24)11-9(15)12(19-18-11)22(25)26/h2-4,6H,5H2,1H3,(H,16,23)(H,17,24)(H,18,19) |
| InChIKey | ZWGTYNWQBWXSDU-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 160.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.75 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|