C23H22N6O3 — CID 19538762
N-[(1,3-diphenylpyrazol-4-yl)methyl]-2-(5-methyl-3-nitropyrazol-1-yl)propanamide (PubChem CID 19538762) has the molecular formula C23H22N6O3 and a molecular weight of 430.47 g/mol. Its IUPAC name is N-[(1,3-diphenylpyrazol-4-yl)methyl]-2-(5-methyl-3-nitropyrazol-1-yl)propanamide.
| Compound Name | N-[(1,3-diphenylpyrazol-4-yl)methyl]-2-(5-methyl-3-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 19538762 |
| Molecular Formula | C23H22N6O3 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | N-[(1,3-diphenylpyrazol-4-yl)methyl]-2-(5-methyl-3-nitropyrazol-1-yl)propanamide |
| SMILES | Cc1cc([N+](=O)[O-])nn1C(C)C(=O)NCc1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C23H22N6O3/c1-16-13-21(29(31)32)25-28(16)17(2)23(30)24-14-19-15-27(20-11-7-4-8-12-20)26-22(19)18-9-5-3-6-10-18/h3-13,15,17H,14H2,1-2H3,(H,24,30) |
| InChIKey | SPOPCUGJFXMAMC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|