C23H19N5O2S — CID 19324990
1-[(1,3-diphenylpyrazol-4-yl)methyl]-3-(4-nitrophenyl)thiourea (PubChem CID 19324990) has the molecular formula C23H19N5O2S and a molecular weight of 429.51 g/mol. Its IUPAC name is 1-[(1,3-diphenylpyrazol-4-yl)methyl]-3-(4-nitrophenyl)thiourea.
| Compound Name | 1-[(1,3-diphenylpyrazol-4-yl)methyl]-3-(4-nitrophenyl)thiourea |
|---|---|
| PubChem CID | 19324990 |
| Molecular Formula | C23H19N5O2S |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 1-[(1,3-diphenylpyrazol-4-yl)methyl]-3-(4-nitrophenyl)thiourea |
| SMILES | O=[N+]([O-])c1ccc(NC(=S)NCc2cn(-c3ccccc3)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H19N5O2S/c29-28(30)21-13-11-19(12-14-21)25-23(31)24-15-18-16-27(20-9-5-2-6-10-20)26-22(18)17-7-3-1-4-8-17/h1-14,16H,15H2,(H2,24,25,31) |
| InChIKey | YCZXDXHSRRVBEQ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|