C20H20N4S — CID 19588911
1-[(1,3-diphenylpyrazol-4-yl)methyl]-3-prop-2-enylthiourea (PubChem CID 19588911) has the molecular formula C20H20N4S and a molecular weight of 348.48 g/mol. Its IUPAC name is 1-[(1,3-diphenylpyrazol-4-yl)methyl]-3-prop-2-enylthiourea.
| Compound Name | 1-[(1,3-diphenylpyrazol-4-yl)methyl]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 19588911 |
| Molecular Formula | C20H20N4S |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 1-[(1,3-diphenylpyrazol-4-yl)methyl]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)NCc1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C20H20N4S/c1-2-13-21-20(25)22-14-17-15-24(18-11-7-4-8-12-18)23-19(17)16-9-5-3-6-10-16/h2-12,15H,1,13-14H2,(H2,21,22,25) |
| InChIKey | XQYMOSXJCJPVLB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|