C31H25N3O — CID 19288782
(Z)-N-[(1,3-diphenylpyrazol-4-yl)methyl]-2,3-diphenylprop-2-enamide (PubChem CID 19288782) has the molecular formula C31H25N3O and a molecular weight of 455.56 g/mol. Its IUPAC name is (Z)-N-[(1,3-diphenylpyrazol-4-yl)methyl]-2,3-diphenylprop-2-enamide.
| Compound Name | (Z)-N-[(1,3-diphenylpyrazol-4-yl)methyl]-2,3-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 19288782 |
| Molecular Formula | C31H25N3O |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | (Z)-N-[(1,3-diphenylpyrazol-4-yl)methyl]-2,3-diphenylprop-2-enamide |
| SMILES | O=C(NCc1cn(-c2ccccc2)nc1-c1ccccc1)/C(=C\c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H25N3O/c35-31(29(25-15-7-2-8-16-25)21-24-13-5-1-6-14-24)32-22-27-23-34(28-19-11-4-12-20-28)33-30(27)26-17-9-3-10-18-26/h1-21,23H,22H2,(H,32,35)/b29-21- |
| InChIKey | YYCVYMAXIKEEAC-ANYBSYGZSA-N |
| XLogP | 6.40 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|