C23H24N6S — CID 19325028
1-[(1,3-diphenylpyrazol-4-yl)methyl]-3-[(1-ethylpyrazol-4-yl)methyl]thiourea (PubChem CID 19325028) has the molecular formula C23H24N6S and a molecular weight of 416.55 g/mol. Its IUPAC name is 1-[(1,3-diphenylpyrazol-4-yl)methyl]-3-[(1-ethylpyrazol-4-yl)methyl]thiourea.
| Compound Name | 1-[(1,3-diphenylpyrazol-4-yl)methyl]-3-[(1-ethylpyrazol-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 19325028 |
| Molecular Formula | C23H24N6S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 1-[(1,3-diphenylpyrazol-4-yl)methyl]-3-[(1-ethylpyrazol-4-yl)methyl]thiourea |
| SMILES | CCn1cc(CNC(=S)NCc2cn(-c3ccccc3)nc2-c2ccccc2)cn1 |
| InChI | InChI=1S/C23H24N6S/c1-2-28-16-18(14-26-28)13-24-23(30)25-15-20-17-29(21-11-7-4-8-12-21)27-22(20)19-9-5-3-6-10-19/h3-12,14,16-17H,2,13,15H2,1H3,(H2,24,25,30) |
| InChIKey | QHTNKEGBGYERGR-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|