C24H19F3N4S — CID 1295858
1-[(1,3-diphenylpyrazol-4-yl)methyl]-3-[2-(trifluoromethyl)phenyl]thiourea (PubChem CID 1295858) has the molecular formula C24H19F3N4S and a molecular weight of 452.51 g/mol. Its IUPAC name is 1-[(1,3-diphenylpyrazol-4-yl)methyl]-3-[2-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[(1,3-diphenylpyrazol-4-yl)methyl]-3-[2-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 1295858 |
| Molecular Formula | C24H19F3N4S |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | 1-[(1,3-diphenylpyrazol-4-yl)methyl]-3-[2-(trifluoromethyl)phenyl]thiourea |
| SMILES | FC(F)(F)c1ccccc1NC(=S)NCc1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C24H19F3N4S/c25-24(26,27)20-13-7-8-14-21(20)29-23(32)28-15-18-16-31(19-11-5-2-6-12-19)30-22(18)17-9-3-1-4-10-17/h1-14,16H,15H2,(H2,28,29,32) |
| InChIKey | JWLSDOJADNOKBC-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|