C29H26F4N4OS — CID 42955406
1-[[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]methyl]-1-(oxolan-2-ylmethyl)-3-[2-(trifluoromethyl)phenyl]thiourea (PubChem CID 42955406) has the molecular formula C29H26F4N4OS and a molecular weight of 554.61 g/mol. Its IUPAC name is 1-[[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]methyl]-1-(oxolan-2-ylmethyl)-3-[2-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]methyl]-1-(oxolan-2-ylmethyl)-3-[2-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 42955406 |
| Molecular Formula | C29H26F4N4OS |
| Molecular Weight | 554.61 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | 1-[[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]methyl]-1-(oxolan-2-ylmethyl)-3-[2-(trifluoromethyl)phenyl]thiourea |
| SMILES | Fc1ccc(-c2nn(-c3ccccc3)cc2CN(CC2CCCO2)C(=S)Nc2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C29H26F4N4OS/c30-22-14-12-20(13-15-22)27-21(18-37(35-27)23-7-2-1-3-8-23)17-36(19-24-9-6-16-38-24)28(39)34-26-11-5-4-10-25(26)29(31,32)33/h1-5,7-8,10-15,18,24H,6,9,16-17,19H2,(H,34,39) |
| InChIKey | RQCWBOYYALAWEI-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.61 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|