C23H22FN3O4 — CID 23876125
[2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 3-(4-fluorophenyl)-1-phenylpyrazole-4-carboxylate (PubChem CID 23876125) has the molecular formula C23H22FN3O4 and a molecular weight of 423.44 g/mol. Its IUPAC name is [2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 3-(4-fluorophenyl)-1-phenylpyrazole-4-carboxylate.
| Compound Name | [2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 3-(4-fluorophenyl)-1-phenylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 23876125 |
| Molecular Formula | C23H22FN3O4 |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | [2-oxo-2-(oxolan-2-ylmethylamino)ethyl] 3-(4-fluorophenyl)-1-phenylpyrazole-4-carboxylate |
| SMILES | O=C(COC(=O)c1cn(-c2ccccc2)nc1-c1ccc(F)cc1)NCC1CCCO1 |
| InChI | InChI=1S/C23H22FN3O4/c24-17-10-8-16(9-11-17)22-20(14-27(26-22)18-5-2-1-3-6-18)23(29)31-15-21(28)25-13-19-7-4-12-30-19/h1-3,5-6,8-11,14,19H,4,7,12-13,15H2,(H,25,28) |
| InChIKey | SLCVVXXMIURBLN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |