C22H16F3N5S2 — CID 2391067
1-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]-3-[2-(trifluoromethyl)phenyl]thiourea (PubChem CID 2391067) has the molecular formula C22H16F3N5S2 and a molecular weight of 471.53 g/mol. Its IUPAC name is 1-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]-3-[2-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]-3-[2-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 2391067 |
| Molecular Formula | C22H16F3N5S2 |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | 1-[(1-phenyl-3-thiophen-2-ylpyrazol-4-yl)methylideneamino]-3-[2-(trifluoromethyl)phenyl]thiourea |
| SMILES | FC(F)(F)c1ccccc1NC(=S)NN=Cc1cn(-c2ccccc2)nc1-c1cccs1 |
| InChI | InChI=1S/C22H16F3N5S2/c23-22(24,25)17-9-4-5-10-18(17)27-21(31)28-26-13-15-14-30(16-7-2-1-3-8-16)29-20(15)19-11-6-12-32-19/h1-14H,(H2,27,28,31) |
| InChIKey | WGEDAEBASAOQRK-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|