C25H23N5S — CID 3966220
1-(2,3-dimethylphenyl)-3-[(1,3-diphenylpyrazol-4-yl)methylideneamino]thiourea (PubChem CID 3966220) has the molecular formula C25H23N5S and a molecular weight of 425.56 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-[(1,3-diphenylpyrazol-4-yl)methylideneamino]thiourea.
| Compound Name | 1-(2,3-dimethylphenyl)-3-[(1,3-diphenylpyrazol-4-yl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 3966220 |
| Molecular Formula | C25H23N5S |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-[(1,3-diphenylpyrazol-4-yl)methylideneamino]thiourea |
| SMILES | Cc1cccc(NC(=S)NN=Cc2cn(-c3ccccc3)nc2-c2ccccc2)c1C |
| InChI | InChI=1S/C25H23N5S/c1-18-10-9-15-23(19(18)2)27-25(31)28-26-16-21-17-30(22-13-7-4-8-14-22)29-24(21)20-11-5-3-6-12-20/h3-17H,1-2H3,(H2,27,28,31) |
| InChIKey | RUXMEUHPSAKVMZ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|