C21H23N5S — CID 3904206
1-(2,3-dimethylphenyl)-3-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]thiourea (PubChem CID 3904206) has the molecular formula C21H23N5S and a molecular weight of 377.52 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]thiourea.
| Compound Name | 1-(2,3-dimethylphenyl)-3-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 3904206 |
| Molecular Formula | C21H23N5S |
| Molecular Weight | 377.52 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylideneamino]thiourea |
| SMILES | Cc1cccc(NC(=S)NN=Cc2c(C)nn(-c3ccccc3)c2C)c1C |
| InChI | InChI=1S/C21H23N5S/c1-14-9-8-12-20(15(14)2)23-21(27)24-22-13-19-16(3)25-26(17(19)4)18-10-6-5-7-11-18/h5-13H,1-4H3,(H2,23,24,27) |
| InChIKey | RWFXAAKIRXQKAR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|