C23H23F3N6S — CID 6905031
1-[(E)-(3-methyl-1-phenyl-5-pyrrolidin-1-ylpyrazol-4-yl)methylideneamino]-3-[2-(trifluoromethyl)phenyl]thiourea (PubChem CID 6905031) has the molecular formula C23H23F3N6S and a molecular weight of 472.54 g/mol. Its IUPAC name is 1-[(E)-(3-methyl-1-phenyl-5-pyrrolidin-1-ylpyrazol-4-yl)methylideneamino]-3-[2-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[(E)-(3-methyl-1-phenyl-5-pyrrolidin-1-ylpyrazol-4-yl)methylideneamino]-3-[2-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 6905031 |
| Molecular Formula | C23H23F3N6S |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 1-[(E)-(3-methyl-1-phenyl-5-pyrrolidin-1-ylpyrazol-4-yl)methylideneamino]-3-[2-(trifluoromethyl)phenyl]thiourea |
| SMILES | Cc1nn(-c2ccccc2)c(N2CCCC2)c1/C=N/NC(=S)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C23H23F3N6S/c1-16-18(15-27-29-22(33)28-20-12-6-5-11-19(20)23(24,25)26)21(31-13-7-8-14-31)32(30-16)17-9-3-2-4-10-17/h2-6,9-12,15H,7-8,13-14H2,1H3,(H2,28,29,33)/b27-15+ |
| InChIKey | OJMMDJVOLZFCLW-JFLMPSFJSA-N |
| XLogP | 5.12 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|