C18H19F3N4S2 — CID 7934391
1-[(Z)-(5-piperidin-1-ylthiophen-2-yl)methylideneamino]-3-[2-(trifluoromethyl)phenyl]thiourea (PubChem CID 7934391) has the molecular formula C18H19F3N4S2 and a molecular weight of 412.51 g/mol. Its IUPAC name is 1-[(Z)-(5-piperidin-1-ylthiophen-2-yl)methylideneamino]-3-[2-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[(Z)-(5-piperidin-1-ylthiophen-2-yl)methylideneamino]-3-[2-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 7934391 |
| Molecular Formula | C18H19F3N4S2 |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 1-[(Z)-(5-piperidin-1-ylthiophen-2-yl)methylideneamino]-3-[2-(trifluoromethyl)phenyl]thiourea |
| SMILES | FC(F)(F)c1ccccc1NC(=S)N/N=C\c1ccc(N2CCCCC2)s1 |
| InChI | InChI=1S/C18H19F3N4S2/c19-18(20,21)14-6-2-3-7-15(14)23-17(26)24-22-12-13-8-9-16(27-13)25-10-4-1-5-11-25/h2-3,6-9,12H,1,4-5,10-11H2,(H2,23,24,26)/b22-12- |
| InChIKey | MAFZWARYFBGKKX-UUYOSTAYSA-N |
| XLogP | 5.08 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|