C17H18ClN3OS — CID 9060165
4-chloro-N-[(Z)-(5-piperidin-1-ylthiophen-2-yl)methylideneamino]benzamide (PubChem CID 9060165) has the molecular formula C17H18ClN3OS and a molecular weight of 347.87 g/mol. Its IUPAC name is 4-chloro-N-[(Z)-(5-piperidin-1-ylthiophen-2-yl)methylideneamino]benzamide.
| Compound Name | 4-chloro-N-[(Z)-(5-piperidin-1-ylthiophen-2-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 9060165 |
| Molecular Formula | C17H18ClN3OS |
| Molecular Weight | 347.87 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 4-chloro-N-[(Z)-(5-piperidin-1-ylthiophen-2-yl)methylideneamino]benzamide |
| SMILES | O=C(N/N=C\c1ccc(N2CCCCC2)s1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H18ClN3OS/c18-14-6-4-13(5-7-14)17(22)20-19-12-15-8-9-16(23-15)21-10-2-1-3-11-21/h4-9,12H,1-3,10-11H2,(H,20,22)/b19-12- |
| InChIKey | QWCPOTJFOGQQMT-UNOMPAQXSA-N |
| XLogP | 4.16 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.87 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|