C17H19ClN4O2S — CID 9231597
N-[(Z)-(4-chloro-2-piperidin-1-yl-1,3-thiazol-5-yl)methylideneamino]-4-methoxybenzamide (PubChem CID 9231597) has the molecular formula C17H19ClN4O2S and a molecular weight of 378.89 g/mol. Its IUPAC name is N-[(Z)-(4-chloro-2-piperidin-1-yl-1,3-thiazol-5-yl)methylideneamino]-4-methoxybenzamide.
| Compound Name | N-[(Z)-(4-chloro-2-piperidin-1-yl-1,3-thiazol-5-yl)methylideneamino]-4-methoxybenzamide |
|---|---|
| PubChem CID | 9231597 |
| Molecular Formula | C17H19ClN4O2S |
| Molecular Weight | 378.89 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | N-[(Z)-(4-chloro-2-piperidin-1-yl-1,3-thiazol-5-yl)methylideneamino]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N/N=C\c2sc(N3CCCCC3)nc2Cl)cc1 |
| InChI | InChI=1S/C17H19ClN4O2S/c1-24-13-7-5-12(6-8-13)16(23)21-19-11-14-15(18)20-17(25-14)22-9-3-2-4-10-22/h5-8,11H,2-4,9-10H2,1H3,(H,21,23)/b19-11- |
| InChIKey | BXHCLEGZDGXDCS-ODLFYWEKSA-N |
| XLogP | 3.56 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.89 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|