C20H21N3O2S — CID 118618781
N-(4-methoxyphenyl)-2-piperidin-1-yl-1,3-benzothiazole-6-carboxamide (PubChem CID 118618781) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-piperidin-1-yl-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-(4-methoxyphenyl)-2-piperidin-1-yl-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 118618781 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | N-(4-methoxyphenyl)-2-piperidin-1-yl-1,3-benzothiazole-6-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccc3nc(N4CCCCC4)sc3c2)cc1 |
| InChI | InChI=1S/C20H21N3O2S/c1-25-16-8-6-15(7-9-16)21-19(24)14-5-10-17-18(13-14)26-20(22-17)23-11-3-2-4-12-23/h5-10,13H,2-4,11-12H2,1H3,(H,21,24) |
| InChIKey | SFZCMBYRCMXVJN-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |