C29H30N4O3S2 — CID 4618906
4-[(4-ethoxyphenoxy)methyl]-N-[(2-piperidin-1-yl-4-thiophen-2-yl-1,3-thiazol-5-yl)methylideneamino]benzamide (PubChem CID 4618906) has the molecular formula C29H30N4O3S2 and a molecular weight of 546.72 g/mol. Its IUPAC name is 4-[(4-ethoxyphenoxy)methyl]-N-[(2-piperidin-1-yl-4-thiophen-2-yl-1,3-thiazol-5-yl)methylideneamino]benzamide.
| Compound Name | 4-[(4-ethoxyphenoxy)methyl]-N-[(2-piperidin-1-yl-4-thiophen-2-yl-1,3-thiazol-5-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 4618906 |
| Molecular Formula | C29H30N4O3S2 |
| Molecular Weight | 546.72 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | 4-[(4-ethoxyphenoxy)methyl]-N-[(2-piperidin-1-yl-4-thiophen-2-yl-1,3-thiazol-5-yl)methylideneamino]benzamide |
| SMILES | CCOc1ccc(OCc2ccc(C(=O)NN=Cc3sc(N4CCCCC4)nc3-c3cccs3)cc2)cc1 |
| InChI | InChI=1S/C29H30N4O3S2/c1-2-35-23-12-14-24(15-13-23)36-20-21-8-10-22(11-9-21)28(34)32-30-19-26-27(25-7-6-18-37-25)31-29(38-26)33-16-4-3-5-17-33/h6-15,18-19H,2-5,16-17,20H2,1H3,(H,32,34) |
| InChIKey | FLTTTYLDGVOWSZ-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 76.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.72 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|