C22H24N4O3S2 — CID 2124019
3,4-dimethoxy-N-[(2-piperidin-1-yl-4-thiophen-2-yl-1,3-thiazol-5-yl)methylideneamino]benzamide (PubChem CID 2124019) has the molecular formula C22H24N4O3S2 and a molecular weight of 456.59 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[(2-piperidin-1-yl-4-thiophen-2-yl-1,3-thiazol-5-yl)methylideneamino]benzamide.
| Compound Name | 3,4-dimethoxy-N-[(2-piperidin-1-yl-4-thiophen-2-yl-1,3-thiazol-5-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 2124019 |
| Molecular Formula | C22H24N4O3S2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 3,4-dimethoxy-N-[(2-piperidin-1-yl-4-thiophen-2-yl-1,3-thiazol-5-yl)methylideneamino]benzamide |
| SMILES | COc1ccc(C(=O)NN=Cc2sc(N3CCCCC3)nc2-c2cccs2)cc1OC |
| InChI | InChI=1S/C22H24N4O3S2/c1-28-16-9-8-15(13-17(16)29-2)21(27)25-23-14-19-20(18-7-6-12-30-18)24-22(31-19)26-10-4-3-5-11-26/h6-9,12-14H,3-5,10-11H2,1-2H3,(H,25,27) |
| InChIKey | NOWGGPULXNTCKP-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 76.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|