C22H27N3O3 — CID 9232157
3,4-dimethoxy-N-[(Z)-1-(4-piperidin-1-ylphenyl)ethylideneamino]benzamide (PubChem CID 9232157) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[(Z)-1-(4-piperidin-1-ylphenyl)ethylideneamino]benzamide.
| Compound Name | 3,4-dimethoxy-N-[(Z)-1-(4-piperidin-1-ylphenyl)ethylideneamino]benzamide |
|---|---|
| PubChem CID | 9232157 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 3,4-dimethoxy-N-[(Z)-1-(4-piperidin-1-ylphenyl)ethylideneamino]benzamide |
| SMILES | COc1ccc(C(=O)N/N=C(/C)c2ccc(N3CCCCC3)cc2)cc1OC |
| InChI | InChI=1S/C22H27N3O3/c1-16(17-7-10-19(11-8-17)25-13-5-4-6-14-25)23-24-22(26)18-9-12-20(27-2)21(15-18)28-3/h7-12,15H,4-6,13-14H2,1-3H3,(H,24,26)/b23-16- |
| InChIKey | SVAFOSFVTVLOPO-KQWNVCNZSA-N |
| XLogP | 3.85 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|