C19H23N3O3S — CID 9460693
3,5-dimethoxy-N-[(Z)-(5-piperidin-1-ylthiophen-2-yl)methylideneamino]benzamide (PubChem CID 9460693) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[(Z)-(5-piperidin-1-ylthiophen-2-yl)methylideneamino]benzamide.
| Compound Name | 3,5-dimethoxy-N-[(Z)-(5-piperidin-1-ylthiophen-2-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 9460693 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 3,5-dimethoxy-N-[(Z)-(5-piperidin-1-ylthiophen-2-yl)methylideneamino]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)N/N=C\c2ccc(N3CCCCC3)s2)c1 |
| InChI | InChI=1S/C19H23N3O3S/c1-24-15-10-14(11-16(12-15)25-2)19(23)21-20-13-17-6-7-18(26-17)22-8-4-3-5-9-22/h6-7,10-13H,3-5,8-9H2,1-2H3,(H,21,23)/b20-13- |
| InChIKey | UCSYMSHYLQJRJH-MOSHPQCFSA-N |
| XLogP | 3.52 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|